C19H20BrCl2N3OS2 — CID 170644129
2-[(1R,5S,6S)-6-amino-5-methoxycyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;hydrochloride (PubChem CID 170644129) has the molecular formula C19H20BrCl2N3OS2 and a molecular weight of 521.33 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-6-amino-5-methoxycyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;hydrochloride.
| Compound Name | 2-[(1R,5S,6S)-6-amino-5-methoxycyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 170644129 |
| Molecular Formula | C19H20BrCl2N3OS2 |
| Molecular Weight | 521.33 g/mol |
| Exact Mass | 518.96 |
| IUPAC Name | 2-[(1R,5S,6S)-6-amino-5-methoxycyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;hydrochloride |
| SMILES | CO[C@H]1C=CC[C@@H](c2sc3c(NCc4cccs4)cc(Cl)nc3c2Br)[C@@H]1N.Cl |
| InChI | InChI=1S/C19H19BrClN3OS2.ClH/c1-25-13-6-2-5-11(16(13)22)18-15(20)17-19(27-18)12(8-14(21)24-17)23-9-10-4-3-7-26-10;/h2-4,6-8,11,13,16H,5,9,22H2,1H3,(H,23,24);1H/t11-,13+,16+;/m1./s1 |
| InChIKey | TZEHQDIOXBZFDV-YSNLIDHRSA-N |
| XLogP | 6.19 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|