C18H17Cl2N3OS2 — CID 170644390
(1R,5S,6R)-6-amino-5-[3,5-dichloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-ol (PubChem CID 170644390) has the molecular formula C18H17Cl2N3OS2 and a molecular weight of 426.39 g/mol. Its IUPAC name is (1R,5S,6R)-6-amino-5-[3,5-dichloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-ol.
| Compound Name | (1R,5S,6R)-6-amino-5-[3,5-dichloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 170644390 |
| Molecular Formula | C18H17Cl2N3OS2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (1R,5S,6R)-6-amino-5-[3,5-dichloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-ol |
| SMILES | N[C@H]1[C@H](O)C=CC[C@@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Cl |
| InChI | InChI=1S/C18H17Cl2N3OS2/c19-13-7-11(22-8-9-3-2-6-25-9)18-16(23-13)14(20)17(26-18)10-4-1-5-12(24)15(10)21/h1-3,5-7,10,12,15,24H,4,8,21H2,(H,22,23)/t10-,12+,15+/m0/s1 |
| InChIKey | JIURUAHUYAAHBQ-JVLSTEMRSA-N |
| XLogP | 5.01 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|