C23H24ClN3O2S2 — CID 170644958
(2S)-5-[2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]pent-4-yne-1,2-diol (PubChem CID 170644958) has the molecular formula C23H24ClN3O2S2 and a molecular weight of 474.05 g/mol. Its IUPAC name is (2S)-5-[2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]pent-4-yne-1,2-diol.
| Compound Name | (2S)-5-[2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]pent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 170644958 |
| Molecular Formula | C23H24ClN3O2S2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | (2S)-5-[2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]pent-4-yne-1,2-diol |
| SMILES | N[C@H]1CC=CC[C@@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1C#CC[C@H](O)CO |
| InChI | InChI=1S/C23H24ClN3O2S2/c24-20-11-19(26-12-15-6-4-10-30-15)23-21(27-20)17(8-3-5-14(29)13-28)22(31-23)16-7-1-2-9-18(16)25/h1-2,4,6,10-11,14,16,18,28-29H,5,7,9,12-13,25H2,(H,26,27)/t14-,16-,18-/m0/s1 |
| InChIKey | UDACBCPOXVFOLA-ZVZYQTTQSA-N |
| XLogP | 4.48 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|