C17H16Cl2N4S2 — CID 170643685
6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2,7-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 170643685) has the molecular formula C17H16Cl2N4S2 and a molecular weight of 411.38 g/mol. Its IUPAC name is 6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2,7-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2,7-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170643685 |
| Molecular Formula | C17H16Cl2N4S2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2,7-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | N[C@H]1CC=CC[C@@H]1c1sc2c(NCc3cccs3)nc(Cl)nc2c1Cl |
| InChI | InChI=1S/C17H16Cl2N4S2/c18-12-13-15(25-14(12)10-5-1-2-6-11(10)20)16(23-17(19)22-13)21-8-9-4-3-7-24-9/h1-4,7,10-11H,5-6,8,20H2,(H,21,22,23)/t10-,11-/m0/s1 |
| InChIKey | WLUVVUHXFPLTDY-QWRGUYRKSA-N |
| XLogP | 5.43 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|