C17H15BrClN3S2 — CID 170644549
7-bromo-2-chloro-6-cyclohex-3-en-1-yl-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 170644549) has the molecular formula C17H15BrClN3S2 and a molecular weight of 440.82 g/mol. Its IUPAC name is 7-bromo-2-chloro-6-cyclohex-3-en-1-yl-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-bromo-2-chloro-6-cyclohex-3-en-1-yl-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170644549 |
| Molecular Formula | C17H15BrClN3S2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 7-bromo-2-chloro-6-cyclohex-3-en-1-yl-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1nc(NCc2cccs2)c2sc(C3CC=CCC3)c(Br)c2n1 |
| InChI | InChI=1S/C17H15BrClN3S2/c18-12-13-15(24-14(12)10-5-2-1-3-6-10)16(22-17(19)21-13)20-9-11-7-4-8-23-11/h1-2,4,7-8,10H,3,5-6,9H2,(H,20,21,22) |
| InChIKey | UBINAWASWFFOBS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|