C19H19BrClN3S2 — CID 170644833
2-[(1S,5R,6S)-6-amino-5-methylcyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644833) has the molecular formula C19H19BrClN3S2 and a molecular weight of 468.87 g/mol. Its IUPAC name is 2-[(1S,5R,6S)-6-amino-5-methylcyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1S,5R,6S)-6-amino-5-methylcyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644833 |
| Molecular Formula | C19H19BrClN3S2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | 2-[(1S,5R,6S)-6-amino-5-methylcyclohex-3-en-1-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | C[C@@H]1C=CC[C@H](c2sc3c(NCc4cccs4)cc(Cl)nc3c2Br)[C@H]1N |
| InChI | InChI=1S/C19H19BrClN3S2/c1-10-4-2-6-12(16(10)22)18-15(20)17-19(26-18)13(8-14(21)24-17)23-9-11-5-3-7-25-11/h2-5,7-8,10,12,16H,6,9,22H2,1H3,(H,23,24)/t10-,12+,16+/m1/s1 |
| InChIKey | AMPPBRQARUANOQ-XAGWURHQSA-N |
| XLogP | 6.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|