C19H17BrClN3O2S2 — CID 170644250
[(1S,5R,6S)-6-amino-5-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-yl] formate (PubChem CID 170644250) has the molecular formula C19H17BrClN3O2S2 and a molecular weight of 498.86 g/mol. Its IUPAC name is [(1S,5R,6S)-6-amino-5-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-yl] formate.
| Compound Name | [(1S,5R,6S)-6-amino-5-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-yl] formate |
|---|---|
| PubChem CID | 170644250 |
| Molecular Formula | C19H17BrClN3O2S2 |
| Molecular Weight | 498.86 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | [(1S,5R,6S)-6-amino-5-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohex-2-en-1-yl] formate |
| SMILES | N[C@@H]1[C@@H](OC=O)C=CC[C@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C19H17BrClN3O2S2/c20-15-17-19(12(7-14(21)24-17)23-8-10-3-2-6-27-10)28-18(15)11-4-1-5-13(16(11)22)26-9-25/h1-3,5-7,9,11,13,16H,4,8,22H2,(H,23,24)/t11-,13+,16+/m1/s1 |
| InChIKey | OQJCOIRTLQAOQX-FFSVYQOJSA-N |
| XLogP | 5.30 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|