C18H20BrClN4S2 — CID 170644087
2-[(4R,5R)-5-aminoazepan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644087) has the molecular formula C18H20BrClN4S2 and a molecular weight of 471.88 g/mol. Its IUPAC name is 2-[(4R,5R)-5-aminoazepan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(4R,5R)-5-aminoazepan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644087 |
| Molecular Formula | C18H20BrClN4S2 |
| Molecular Weight | 471.88 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 2-[(4R,5R)-5-aminoazepan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H]1CCNCC[C@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C18H20BrClN4S2/c19-15-16-18(26-17(15)11-3-5-22-6-4-12(11)21)13(8-14(20)24-16)23-9-10-2-1-7-25-10/h1-2,7-8,11-12,22H,3-6,9,21H2,(H,23,24)/t11-,12-/m1/s1 |
| InChIKey | ILIQTRUPGGNRHS-VXGBXAGGSA-N |
| XLogP | 5.18 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|