C18H18ClN3S2 — CID 170643799
2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170643799) has the molecular formula C18H18ClN3S2 and a molecular weight of 375.95 g/mol. Its IUPAC name is 2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170643799 |
| Molecular Formula | C18H18ClN3S2 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@H]1CC=CC[C@@H]1c1cc2nc(Cl)cc(NCc3cccs3)c2s1 |
| InChI | InChI=1S/C18H18ClN3S2/c19-17-9-14(21-10-11-4-3-7-23-11)18-15(22-17)8-16(24-18)12-5-1-2-6-13(12)20/h1-4,7-9,12-13H,5-6,10,20H2,(H,21,22)/t12-,13-/m0/s1 |
| InChIKey | SOZKXJWXMRTNSW-STQMWFEESA-N |
| XLogP | 5.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|