C23H23ClF3N3O4S2 — CID 175971894
4-[2-[(2S,3S)-3-aminooxan-2-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]but-3-yn-1-ol;2,2,2-trifluoroacetic acid (PubChem CID 175971894) has the molecular formula C23H23ClF3N3O4S2 and a molecular weight of 562.04 g/mol. Its IUPAC name is 4-[2-[(2S,3S)-3-aminooxan-2-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]but-3-yn-1-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[(2S,3S)-3-aminooxan-2-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]but-3-yn-1-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175971894 |
| Molecular Formula | C23H23ClF3N3O4S2 |
| Molecular Weight | 562.04 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | 4-[2-[(2S,3S)-3-aminooxan-2-yl]-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-3-yl]but-3-yn-1-ol;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H]1CCCO[C@@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1C#CCCO.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H22ClN3O2S2.C2HF3O2/c22-17-11-16(24-12-13-5-4-10-28-13)21-18(25-17)14(6-1-2-8-26)20(29-21)19-15(23)7-3-9-27-19;3-2(4,5)1(6)7/h4-5,10-11,15,19,26H,2-3,7-9,12,23H2,(H,24,25);(H,6,7)/t15-,19-;/m0./s1 |
| InChIKey | WSVCDKIOCFEWLW-GIDGLZBFSA-N |
| XLogP | 5.17 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.04 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|