C25H23BrClF3N4O2S2 — CID 175971950
2-[(2R,3S)-3-amino-1-phenylpiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 175971950) has the molecular formula C25H23BrClF3N4O2S2 and a molecular weight of 647.97 g/mol. Its IUPAC name is 2-[(2R,3S)-3-amino-1-phenylpiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2R,3S)-3-amino-1-phenylpiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175971950 |
| Molecular Formula | C25H23BrClF3N4O2S2 |
| Molecular Weight | 647.97 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | 2-[(2R,3S)-3-amino-1-phenylpiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H]1CCCN(c2ccccc2)[C@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H22BrClN4S2.C2HF3O2/c24-19-20-22(17(12-18(25)28-20)27-13-15-8-5-11-30-15)31-23(19)21-16(26)9-4-10-29(21)14-6-2-1-3-7-14;3-2(4,5)1(6)7/h1-3,5-8,11-12,16,21H,4,9-10,13,26H2,(H,27,28);(H,6,7)/t16-,21+;/m0./s1 |
| InChIKey | VHUSMFCUQXAVBD-SWSMCDPZSA-N |
| XLogP | 7.69 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.97 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|