C21H17Cl2FN4O2S — CID 175190948
2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 175190948) has the molecular formula C21H17Cl2FN4O2S and a molecular weight of 479.36 g/mol. Its IUPAC name is 2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 175190948 |
| Molecular Formula | C21H17Cl2FN4O2S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | NC(Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Cl)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C21H17Cl2FN4O2S/c22-17-9-15(26-10-11-4-3-7-30-11)20-19(28-17)18(23)16(31-20)8-13(25)21(29)27-14-6-2-1-5-12(14)24/h1-7,9,13H,8,10,25H2,(H,26,28)(H,27,29) |
| InChIKey | RFEZQRIRTRZEOM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|