C22H18BrClN4O5S3 — CID 162391080
N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-4-oxobutan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 162391080) has the molecular formula C22H18BrClN4O5S3 and a molecular weight of 629.97 g/mol. Its IUPAC name is N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-4-oxobutan-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-4-oxobutan-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 162391080 |
| Molecular Formula | C22H18BrClN4O5S3 |
| Molecular Weight | 629.97 g/mol |
| Exact Mass | 627.93 |
| IUPAC Name | N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]-4-oxobutan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=CC[C@@H](Cc1sc2c(NCc3cccs3)cc(Cl)nc2c1Br)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18BrClN4O5S3/c23-20-17(35-22-15(11-19(24)26-21(20)22)25-12-14-4-3-9-34-14)10-13(7-8-29)27-36(32,33)18-6-2-1-5-16(18)28(30)31/h1-6,8-9,11,13,27H,7,10,12H2,(H,25,26)/t13-/m0/s1 |
| InChIKey | YEUBVROSVVBOAG-ZDUSSCGKSA-N |
| XLogP | 5.77 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|