C21H23ClN2S2 — CID 170643758
5-chloro-2-cyclohexyl-3-cyclopropyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170643758) has the molecular formula C21H23ClN2S2 and a molecular weight of 403.02 g/mol. Its IUPAC name is 5-chloro-2-cyclohexyl-3-cyclopropyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 5-chloro-2-cyclohexyl-3-cyclopropyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170643758 |
| Molecular Formula | C21H23ClN2S2 |
| Molecular Weight | 403.02 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 5-chloro-2-cyclohexyl-3-cyclopropyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Clc1cc(NCc2cccs2)c2sc(C3CCCCC3)c(C3CC3)c2n1 |
| InChI | InChI=1S/C21H23ClN2S2/c22-17-11-16(23-12-15-7-4-10-25-15)21-19(24-17)18(13-8-9-13)20(26-21)14-5-2-1-3-6-14/h4,7,10-11,13-14H,1-3,5-6,8-9,12H2,(H,23,24) |
| InChIKey | JQBDWPKZMOFFKK-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.02 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|