C18H22Cl2FN5O2 — CID 170644127
2,7-dichloro-5-N-fluoro-4-N-(furan-2-ylmethyl)-5-N-(oxan-3-yl)pyrrolo[3,2-d]pyrimidine-4,5-diamine;ethane (PubChem CID 170644127) has the molecular formula C18H22Cl2FN5O2 and a molecular weight of 430.31 g/mol. Its IUPAC name is 2,7-dichloro-5-N-fluoro-4-N-(furan-2-ylmethyl)-5-N-(oxan-3-yl)pyrrolo[3,2-d]pyrimidine-4,5-diamine;ethane.
| Compound Name | 2,7-dichloro-5-N-fluoro-4-N-(furan-2-ylmethyl)-5-N-(oxan-3-yl)pyrrolo[3,2-d]pyrimidine-4,5-diamine;ethane |
|---|---|
| PubChem CID | 170644127 |
| Molecular Formula | C18H22Cl2FN5O2 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2,7-dichloro-5-N-fluoro-4-N-(furan-2-ylmethyl)-5-N-(oxan-3-yl)pyrrolo[3,2-d]pyrimidine-4,5-diamine;ethane |
| SMILES | CC.FN(C1CCCOC1)n1cc(Cl)c2nc(Cl)nc(NCc3ccco3)c21 |
| InChI | InChI=1S/C16H16Cl2FN5O2.C2H6/c17-12-8-23(24(19)10-3-1-5-25-9-10)14-13(12)21-16(18)22-15(14)20-7-11-4-2-6-26-11;1-2/h2,4,6,8,10H,1,3,5,7,9H2,(H,20,21,22);1-2H3 |
| InChIKey | HECOGMGAIFMEFM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|