C18H19Cl2F2N5O — CID 178114343
6-[(1R,2S)-2-amino-4,4-difluorocyclohexyl]-2,7-dichloro-N-(furan-2-ylmethyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 178114343) has the molecular formula C18H19Cl2F2N5O and a molecular weight of 430.29 g/mol. Its IUPAC name is 6-[(1R,2S)-2-amino-4,4-difluorocyclohexyl]-2,7-dichloro-N-(furan-2-ylmethyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 6-[(1R,2S)-2-amino-4,4-difluorocyclohexyl]-2,7-dichloro-N-(furan-2-ylmethyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 178114343 |
| Molecular Formula | C18H19Cl2F2N5O |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 6-[(1R,2S)-2-amino-4,4-difluorocyclohexyl]-2,7-dichloro-N-(furan-2-ylmethyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1c([C@H]2CCC(F)(F)C[C@@H]2N)c(Cl)n2nc(Cl)nc(NCc3ccco3)c12 |
| InChI | InChI=1S/C18H19Cl2F2N5O/c1-9-13(11-4-5-18(21,22)7-12(11)23)15(19)27-14(9)16(25-17(20)26-27)24-8-10-3-2-6-28-10/h2-3,6,11-12H,4-5,7-8,23H2,1H3,(H,24,25,26)/t11-,12-/m0/s1 |
| InChIKey | PXQJTWAFLJOZLK-RYUDHWBXSA-N |
| XLogP | 4.78 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |