C16H15ClF4N4O — CID 178114303
2-chloro-5-fluoro-N-(furan-2-ylmethyl)-7-methyl-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 178114303) has the molecular formula C16H15ClF4N4O and a molecular weight of 390.77 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(furan-2-ylmethyl)-7-methyl-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-(furan-2-ylmethyl)-7-methyl-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 178114303 |
| Molecular Formula | C16H15ClF4N4O |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-chloro-5-fluoro-N-(furan-2-ylmethyl)-7-methyl-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1c(CCCC(F)(F)F)c(F)c2c(NCc3ccco3)nc(Cl)nn12 |
| InChI | InChI=1S/C16H15ClF4N4O/c1-9-11(5-2-6-16(19,20)21)12(18)13-14(23-15(17)24-25(9)13)22-8-10-4-3-7-26-10/h3-4,7H,2,5-6,8H2,1H3,(H,22,23,24) |
| InChIKey | DIHQIWFDMFQQBO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |