C15H12Cl2F4N4S — CID 178114135
2,7-dichloro-5-fluoro-N-(thiophen-2-ylmethyl)-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 178114135) has the molecular formula C15H12Cl2F4N4S and a molecular weight of 427.25 g/mol. Its IUPAC name is 2,7-dichloro-5-fluoro-N-(thiophen-2-ylmethyl)-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2,7-dichloro-5-fluoro-N-(thiophen-2-ylmethyl)-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 178114135 |
| Molecular Formula | C15H12Cl2F4N4S |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2,7-dichloro-5-fluoro-N-(thiophen-2-ylmethyl)-6-(4,4,4-trifluorobutyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Fc1c(CCCC(F)(F)F)c(Cl)n2nc(Cl)nc(NCc3cccs3)c12 |
| InChI | InChI=1S/C15H12Cl2F4N4S/c16-12-9(4-1-5-15(19,20)21)10(18)11-13(23-14(17)24-25(11)12)22-7-8-3-2-6-26-8/h2-3,6H,1,4-5,7H2,(H,22,23,24) |
| InChIKey | FHVDYCQNVQDIDJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |