C10H10ClN3S — CID 63729925
6-chloro-5-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 63729925) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 63729925 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 6-chloro-5-methyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1c(Cl)ncnc1NCc1cccs1 |
| InChI | InChI=1S/C10H10ClN3S/c1-7-9(11)13-6-14-10(7)12-5-8-3-2-4-15-8/h2-4,6H,5H2,1H3,(H,12,13,14) |
| InChIKey | YGSVDFDKDKWJSV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |