C10H8Cl2N2S — CID 43242469
3,5-dichloro-N-(thiophen-2-ylmethyl)pyridin-2-amine (PubChem CID 43242469) has the molecular formula C10H8Cl2N2S and a molecular weight of 259.16 g/mol. Its IUPAC name is 3,5-dichloro-N-(thiophen-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(thiophen-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 43242469 |
| Molecular Formula | C10H8Cl2N2S |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 3,5-dichloro-N-(thiophen-2-ylmethyl)pyridin-2-amine |
| SMILES | Clc1cnc(NCc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2S/c11-7-4-9(12)10(13-5-7)14-6-8-2-1-3-15-8/h1-5H,6H2,(H,13,14) |
| InChIKey | NQMINPXDNRICDQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |