C13H12Cl2N2O — CID 29285859
3,5-dichloro-N-[(4-methoxyphenyl)methyl]pyridin-2-amine (PubChem CID 29285859) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is 3,5-dichloro-N-[(4-methoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(4-methoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 29285859 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3,5-dichloro-N-[(4-methoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1ccc(CNc2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H12Cl2N2O/c1-18-11-4-2-9(3-5-11)7-16-13-12(15)6-10(14)8-17-13/h2-6,8H,7H2,1H3,(H,16,17) |
| InChIKey | JFMLKFGLKFSKMD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |