C16H13ClFN3O — CID 168957431
6-chloro-8-fluoro-N-[(4-methoxyphenyl)methyl]phthalazin-1-amine (PubChem CID 168957431) has the molecular formula C16H13ClFN3O and a molecular weight of 317.75 g/mol. Its IUPAC name is 6-chloro-8-fluoro-N-[(4-methoxyphenyl)methyl]phthalazin-1-amine.
| Compound Name | 6-chloro-8-fluoro-N-[(4-methoxyphenyl)methyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 168957431 |
| Molecular Formula | C16H13ClFN3O |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 6-chloro-8-fluoro-N-[(4-methoxyphenyl)methyl]phthalazin-1-amine |
| SMILES | COc1ccc(CNc2nncc3cc(Cl)cc(F)c23)cc1 |
| InChI | InChI=1S/C16H13ClFN3O/c1-22-13-4-2-10(3-5-13)8-19-16-15-11(9-20-21-16)6-12(17)7-14(15)18/h2-7,9H,8H2,1H3,(H,19,21) |
| InChIKey | RWALKVXYSGWMNG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |