C16H16Cl2F3N5S — CID 178114266
6-[(2R)-2-amino-4,4,4-trifluorobutyl]-2,7-dichloro-5-methyl-N-(thiophen-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 178114266) has the molecular formula C16H16Cl2F3N5S and a molecular weight of 438.31 g/mol. Its IUPAC name is 6-[(2R)-2-amino-4,4,4-trifluorobutyl]-2,7-dichloro-5-methyl-N-(thiophen-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 6-[(2R)-2-amino-4,4,4-trifluorobutyl]-2,7-dichloro-5-methyl-N-(thiophen-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 178114266 |
| Molecular Formula | C16H16Cl2F3N5S |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 6-[(2R)-2-amino-4,4,4-trifluorobutyl]-2,7-dichloro-5-methyl-N-(thiophen-2-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1c(C[C@@H](N)CC(F)(F)F)c(Cl)n2nc(Cl)nc(NCc3cccs3)c12 |
| InChI | InChI=1S/C16H16Cl2F3N5S/c1-8-11(5-9(22)6-16(19,20)21)13(17)26-12(8)14(24-15(18)25-26)23-7-10-3-2-4-27-10/h2-4,9H,5-7,22H2,1H3,(H,23,24,25)/t9-/m1/s1 |
| InChIKey | YJWGLGVBBHIGRN-SECBINFHSA-N |
| XLogP | 4.84 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |