C23H30ClF2N5 — CID 170644877
N-benzyl-2-chloro-5-(difluoromethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine;cyclohex-3-en-1-amine;ethane (PubChem CID 170644877) has the molecular formula C23H30ClF2N5 and a molecular weight of 449.98 g/mol. Its IUPAC name is N-benzyl-2-chloro-5-(difluoromethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine;cyclohex-3-en-1-amine;ethane.
| Compound Name | N-benzyl-2-chloro-5-(difluoromethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine;cyclohex-3-en-1-amine;ethane |
|---|---|
| PubChem CID | 170644877 |
| Molecular Formula | C23H30ClF2N5 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-benzyl-2-chloro-5-(difluoromethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine;cyclohex-3-en-1-amine;ethane |
| SMILES | CC.Cc1cn(C(F)F)c2c(NCc3ccccc3)nc(Cl)nc12.NC1CC=CCC1 |
| InChI | InChI=1S/C15H13ClF2N4.C6H11N.C2H6/c1-9-8-22(15(17)18)12-11(9)20-14(16)21-13(12)19-7-10-5-3-2-4-6-10;7-6-4-2-1-3-5-6;1-2/h2-6,8,15H,7H2,1H3,(H,19,20,21);1-2,6H,3-5,7H2;1-2H3 |
| InChIKey | LKQRLFIMVVYLGE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|