C15H16ClN5 — CID 82460318
N-benzyl-2-chloro-7-propan-2-ylpurin-6-amine (PubChem CID 82460318) has the molecular formula C15H16ClN5 and a molecular weight of 301.78 g/mol. Its IUPAC name is N-benzyl-2-chloro-7-propan-2-ylpurin-6-amine.
| Compound Name | N-benzyl-2-chloro-7-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 82460318 |
| Molecular Formula | C15H16ClN5 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-benzyl-2-chloro-7-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2nc(Cl)nc(NCc3ccccc3)c21 |
| InChI | InChI=1S/C15H16ClN5/c1-10(2)21-9-18-14-12(21)13(19-15(16)20-14)17-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,17,19,20) |
| InChIKey | KLQGLOSNOHUXAJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |