C13H20ClN5 — CID 82460374
2-chloro-N,7-bis(2-methylpropyl)purin-6-amine (PubChem CID 82460374) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is 2-chloro-N,7-bis(2-methylpropyl)purin-6-amine.
| Compound Name | 2-chloro-N,7-bis(2-methylpropyl)purin-6-amine |
|---|---|
| PubChem CID | 82460374 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-chloro-N,7-bis(2-methylpropyl)purin-6-amine |
| SMILES | CC(C)CNc1nc(Cl)nc2ncn(CC(C)C)c12 |
| InChI | InChI=1S/C13H20ClN5/c1-8(2)5-15-11-10-12(18-13(14)17-11)16-7-19(10)6-9(3)4/h7-9H,5-6H2,1-4H3,(H,15,17,18) |
| InChIKey | ZEGFEDVEUQXFTI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |