C12H19ClN6 — CID 82460256
N-(2-chloro-7-ethylpurin-6-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 82460256) has the molecular formula C12H19ClN6 and a molecular weight of 282.78 g/mol. Its IUPAC name is N-(2-chloro-7-ethylpurin-6-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2-chloro-7-ethylpurin-6-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82460256 |
| Molecular Formula | C12H19ClN6 |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(2-chloro-7-ethylpurin-6-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCn1cnc2nc(Cl)nc(NCCCN(C)C)c21 |
| InChI | InChI=1S/C12H19ClN6/c1-4-19-8-15-11-9(19)10(16-12(13)17-11)14-6-5-7-18(2)3/h8H,4-7H2,1-3H3,(H,14,16,17) |
| InChIKey | UELAVONLJFMXGO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|