C14H21ClN6 — CID 82460201
2-chloro-7-methyl-N-(4-pyrrolidin-1-ylbutyl)purin-6-amine (PubChem CID 82460201) has the molecular formula C14H21ClN6 and a molecular weight of 308.82 g/mol. Its IUPAC name is 2-chloro-7-methyl-N-(4-pyrrolidin-1-ylbutyl)purin-6-amine.
| Compound Name | 2-chloro-7-methyl-N-(4-pyrrolidin-1-ylbutyl)purin-6-amine |
|---|---|
| PubChem CID | 82460201 |
| Molecular Formula | C14H21ClN6 |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-chloro-7-methyl-N-(4-pyrrolidin-1-ylbutyl)purin-6-amine |
| SMILES | Cn1cnc2nc(Cl)nc(NCCCCN3CCCC3)c21 |
| InChI | InChI=1S/C14H21ClN6/c1-20-10-17-13-11(20)12(18-14(15)19-13)16-6-2-3-7-21-8-4-5-9-21/h10H,2-9H2,1H3,(H,16,18,19) |
| InChIKey | ZRSXZPHIIBBOIL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|