C15H24N6 — CID 110431932
1,3-dimethyl-N-(4-pyrrolidin-1-ylbutyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 110431932) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 1,3-dimethyl-N-(4-pyrrolidin-1-ylbutyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1,3-dimethyl-N-(4-pyrrolidin-1-ylbutyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110431932 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1,3-dimethyl-N-(4-pyrrolidin-1-ylbutyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nn(C)c2ncnc(NCCCCN3CCCC3)c12 |
| InChI | InChI=1S/C15H24N6/c1-12-13-14(17-11-18-15(13)20(2)19-12)16-7-3-4-8-21-9-5-6-10-21/h11H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | IXDUCHNZCBVBNR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|