C10H14BrN5S — CID 133305017
3-bromo-1-methyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 133305017) has the molecular formula C10H14BrN5S and a molecular weight of 316.23 g/mol. Its IUPAC name is 3-bromo-1-methyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-bromo-1-methyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133305017 |
| Molecular Formula | C10H14BrN5S |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 3-bromo-1-methyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CSCCCNc1ncnc2c1c(Br)nn2C |
| InChI | InChI=1S/C10H14BrN5S/c1-16-10-7(8(11)15-16)9(13-6-14-10)12-4-3-5-17-2/h6H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | CDDNZYQKUVQWAR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|