C26H27ClN4OS2 — CID 170644616
5-amino-N-phenylcyclohexene-1-carboxamide;5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644616) has the molecular formula C26H27ClN4OS2 and a molecular weight of 511.12 g/mol. Its IUPAC name is 5-amino-N-phenylcyclohexene-1-carboxamide;5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 5-amino-N-phenylcyclohexene-1-carboxamide;5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644616 |
| Molecular Formula | C26H27ClN4OS2 |
| Molecular Weight | 511.12 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 5-amino-N-phenylcyclohexene-1-carboxamide;5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1csc2c(NCc3cccs3)cc(Cl)nc12.NC1CCC=C(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C13H11ClN2S2.C13H16N2O/c1-8-7-18-13-10(5-11(14)16-12(8)13)15-6-9-3-2-4-17-9;14-11-6-4-5-10(9-11)13(16)15-12-7-2-1-3-8-12/h2-5,7H,6H2,1H3,(H,15,16);1-3,5,7-8,11H,4,6,9,14H2,(H,15,16) |
| InChIKey | LGTUWZRGVYEASL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.12 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|