C11H17NO3 — CID 115027359
2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanol (PubChem CID 115027359) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanol.
| Compound Name | 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanol |
|---|---|
| PubChem CID | 115027359 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanol |
| SMILES | Cc1oc(CCO)nc1C1CCCOC1 |
| InChI | InChI=1S/C11H17NO3/c1-8-11(9-3-2-6-14-7-9)12-10(15-8)4-5-13/h9,13H,2-7H2,1H3 |
| InChIKey | WTFIZLFVWRKXAJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |