C11H18N2O2 — CID 115026947
2-(5-methyl-4-piperidin-2-yl-1,3-oxazol-2-yl)ethanol (PubChem CID 115026947) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(5-methyl-4-piperidin-2-yl-1,3-oxazol-2-yl)ethanol.
| Compound Name | 2-(5-methyl-4-piperidin-2-yl-1,3-oxazol-2-yl)ethanol |
|---|---|
| PubChem CID | 115026947 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(5-methyl-4-piperidin-2-yl-1,3-oxazol-2-yl)ethanol |
| SMILES | Cc1oc(CCO)nc1C1CCCCN1 |
| InChI | InChI=1S/C11H18N2O2/c1-8-11(9-4-2-3-6-12-9)13-10(15-8)5-7-14/h9,12,14H,2-7H2,1H3 |
| InChIKey | MSCSXOZJZHYHAY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |