2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid

C10H14N2O3 — CID 115026802

IUPAC2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid
SMILESCc1oc(CC(=O)O)nc1C1CCCN1
InChIInChI=1S/C10H14N2O3/c1-6-10(7-3-2-4-11-7)12-8(15-6)5-9(13)14/h7,11H,2-5H2,1H3,(H,13,14)
InChIKeyDLNXIMALVUTGED-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.03
Rot. Bonds3

About 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid

2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid (PubChem CID 115026802) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid
PubChem CID115026802
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid
SMILESCc1oc(CC(=O)O)nc1C1CCCN1
InChIInChI=1S/C10H14N2O3/c1-6-10(7-3-2-4-11-7)12-8(15-6)5-9(13)14/h7,11H,2-5H2,1H3,(H,13,14)
InChIKeyDLNXIMALVUTGED-UHFFFAOYSA-N
XLogP1.03
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid?
The IUPAC name of 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid (CID 115026802) is 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid.
What is the SMILES notation for 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid?
The canonical SMILES for 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid is Cc1oc(CC(=O)O)nc1C1CCCN1.
What is the InChIKey of 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid?
The InChIKey is DLNXIMALVUTGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-6-10(7-3-2-4-11-7)12-8(15-6)5-9(13)14/h7,11H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid?
2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid has a molecular weight of 210.23 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-4-pyrrolidin-2-yl-1,3-oxazol-2-yl)acetic acid is sourced from PubChem (CID 115026802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).