3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid

C9H12N2O3 — CID 102537895

IUPAC3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid
SMILESO=C(O)c1conc1C1CCCCN1
InChIInChI=1S/C9H12N2O3/c12-9(13)6-5-14-11-8(6)7-3-1-2-4-10-7/h5,7,10H,1-4H2,(H,12,13)
InChIKeyXFRVLQCKAKWAKV-UHFFFAOYSA-N
MW196.21 g/mol
LogP1.19
Rot. Bonds2

About 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid

3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid (PubChem CID 102537895) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid
PubChem CID102537895
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Name3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid
SMILESO=C(O)c1conc1C1CCCCN1
InChIInChI=1S/C9H12N2O3/c12-9(13)6-5-14-11-8(6)7-3-1-2-4-10-7/h5,7,10H,1-4H2,(H,12,13)
InChIKeyXFRVLQCKAKWAKV-UHFFFAOYSA-N
XLogP1.19
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 51.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid (CID 102537895) is 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid is O=C(O)c1conc1C1CCCCN1.
What is the InChIKey of 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid?
The InChIKey is XFRVLQCKAKWAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-9(13)6-5-14-11-8(6)7-3-1-2-4-10-7/h5,7,10H,1-4H2,(H,12,13).
What are the key properties of 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid?
3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-2-yl-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 102537895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).