C12H15NO4 — CID 117346375
2,4-dihydroxy-5-piperidin-2-ylbenzoic acid (PubChem CID 117346375) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2,4-dihydroxy-5-piperidin-2-ylbenzoic acid.
| Compound Name | 2,4-dihydroxy-5-piperidin-2-ylbenzoic acid |
|---|---|
| PubChem CID | 117346375 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,4-dihydroxy-5-piperidin-2-ylbenzoic acid |
| SMILES | O=C(O)c1cc(C2CCCCN2)c(O)cc1O |
| InChI | InChI=1S/C12H15NO4/c14-10-6-11(15)8(12(16)17)5-7(10)9-3-1-2-4-13-9/h5-6,9,13-15H,1-4H2,(H,16,17) |
| InChIKey | JSDPWPIRJNLUKF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|