C12H13NO6 — CID 117421187
5-(5-carboxy-2,4-dihydroxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117421187) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is 5-(5-carboxy-2,4-dihydroxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(5-carboxy-2,4-dihydroxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117421187 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-(5-carboxy-2,4-dihydroxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CC(C(=O)O)CN2)c(O)cc1O |
| InChI | InChI=1S/C12H13NO6/c14-9-3-10(15)7(12(18)19)2-6(9)8-1-5(4-13-8)11(16)17/h2-3,5,8,13-15H,1,4H2,(H,16,17)(H,18,19) |
| InChIKey | JMAAKYFGHKLBEF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|