About 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid
5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117499268) has the molecular formula C13H16BrNO3
and a molecular weight of 314.18 g/mol. Its IUPAC name is 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 117499268 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(C2CC(C(=O)O)CN2)c(O)c(Br)c1C |
| InChI | InChI=1S/C13H16BrNO3/c1-6-3-9(12(16)11(14)7(6)2)10-4-8(5-15-10)13(17)18/h3,8,10,15-16H,4-5H2,1-2H3,(H,17,18) |
| InChIKey | BYAMDYMXZOWEQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid (CID 117499268) is 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid is Cc1cc(C2CC(C(=O)O)CN2)c(O)c(Br)c1C.
What is the InChIKey of 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid?
The InChIKey is BYAMDYMXZOWEQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO3/c1-6-3-9(12(16)11(14)7(6)2)10-4-8(5-15-10)13(17)18/h3,8,10,15-16H,4-5H2,1-2H3,(H,17,18).
What are the key properties of 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid?
5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid has a molecular weight of 314.18 g/mol, XLogP of 2.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromo-2-hydroxy-4,5-dimethylphenyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 117499268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).