C13H16ClNO3 — CID 117427410
5-(5-chloro-2-hydroxy-3,6-dimethylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117427410) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 5-(5-chloro-2-hydroxy-3,6-dimethylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(5-chloro-2-hydroxy-3,6-dimethylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117427410 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-(5-chloro-2-hydroxy-3,6-dimethylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)c(C)c(C2CC(C(=O)O)CN2)c1O |
| InChI | InChI=1S/C13H16ClNO3/c1-6-3-9(14)7(2)11(12(6)16)10-4-8(5-15-10)13(17)18/h3,8,10,15-16H,4-5H2,1-2H3,(H,17,18) |
| InChIKey | VFECJIAXXRVBQB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|