C12H14ClNO3 — CID 117392326
5-(3-chloro-6-hydroxy-2-methylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117392326) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 5-(3-chloro-6-hydroxy-2-methylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(3-chloro-6-hydroxy-2-methylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117392326 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 5-(3-chloro-6-hydroxy-2-methylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1c(Cl)ccc(O)c1C1CC(C(=O)O)CN1 |
| InChI | InChI=1S/C12H14ClNO3/c1-6-8(13)2-3-10(15)11(6)9-4-7(5-14-9)12(16)17/h2-3,7,9,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | OFFJMNAKWNWDTP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|