C11H12BrNO4 — CID 117486094
5-(6-bromo-2,3-dihydroxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117486094) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is 5-(6-bromo-2,3-dihydroxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(6-bromo-2,3-dihydroxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117486094 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 5-(6-bromo-2,3-dihydroxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2c(Br)ccc(O)c2O)C1 |
| InChI | InChI=1S/C11H12BrNO4/c12-6-1-2-8(14)10(15)9(6)7-3-5(4-13-7)11(16)17/h1-2,5,7,13-15H,3-4H2,(H,16,17) |
| InChIKey | JKALDGCNRZVVLY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|