C12H9F4NO4 — CID 117492218
5-(4-carboxy-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117492218) has the molecular formula C12H9F4NO4 and a molecular weight of 307.20 g/mol. Its IUPAC name is 5-(4-carboxy-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(4-carboxy-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117492218 |
| Molecular Formula | C12H9F4NO4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 5-(4-carboxy-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)c1c(F)c(F)c(C2CC(C(=O)O)CN2)c(F)c1F |
| InChI | InChI=1S/C12H9F4NO4/c13-7-5(4-1-3(2-17-4)11(18)19)8(14)10(16)6(9(7)15)12(20)21/h3-4,17H,1-2H2,(H,18,19)(H,20,21) |
| InChIKey | XBBHZVSZDIQKLE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|