C11H10ClF2NO3 — CID 117445079
5-(5-chloro-2,3-difluoro-4-hydroxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117445079) has the molecular formula C11H10ClF2NO3 and a molecular weight of 277.65 g/mol. Its IUPAC name is 5-(5-chloro-2,3-difluoro-4-hydroxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(5-chloro-2,3-difluoro-4-hydroxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117445079 |
| Molecular Formula | C11H10ClF2NO3 |
| Molecular Weight | 277.65 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 5-(5-chloro-2,3-difluoro-4-hydroxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2cc(Cl)c(O)c(F)c2F)C1 |
| InChI | InChI=1S/C11H10ClF2NO3/c12-6-2-5(8(13)9(14)10(6)16)7-1-4(3-15-7)11(17)18/h2,4,7,15-16H,1,3H2,(H,17,18) |
| InChIKey | YNUHJWITYYKDCA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|