C12H12FNO5 — CID 117425961
5-(7-fluoro-6-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117425961) has the molecular formula C12H12FNO5 and a molecular weight of 269.23 g/mol. Its IUPAC name is 5-(7-fluoro-6-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(7-fluoro-6-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117425961 |
| Molecular Formula | C12H12FNO5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-(7-fluoro-6-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2cc3c(c(F)c2O)OCO3)C1 |
| InChI | InChI=1S/C12H12FNO5/c13-9-10(15)6(2-8-11(9)19-4-18-8)7-1-5(3-14-7)12(16)17/h2,5,7,14-15H,1,3-4H2,(H,16,17) |
| InChIKey | QXGZQWGZGPGZBC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|