C12H13NO5 — CID 117380536
5-(4-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117380536) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 5-(4-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(4-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117380536 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 5-(4-hydroxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2ccc3c(c2O)OCO3)C1 |
| InChI | InChI=1S/C12H13NO5/c14-10-7(1-2-9-11(10)18-5-17-9)8-3-6(4-13-8)12(15)16/h1-2,6,8,13-14H,3-5H2,(H,15,16) |
| InChIKey | UKNGDIUNBAKMHX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|