C11H11ClFNO2 — CID 117361084
5-(2-chloro-3-fluorophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117361084) has the molecular formula C11H11ClFNO2 and a molecular weight of 243.66 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(2-chloro-3-fluorophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117361084 |
| Molecular Formula | C11H11ClFNO2 |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2cccc(F)c2Cl)C1 |
| InChI | InChI=1S/C11H11ClFNO2/c12-10-7(2-1-3-8(10)13)9-4-6(5-14-9)11(15)16/h1-3,6,9,14H,4-5H2,(H,15,16) |
| InChIKey | VGUNUYBHCXNDFX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |