C12H11ClF3NO2 — CID 117117066
5-[4-chloro-2-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 117117066) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is 5-[4-chloro-2-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 5-[4-chloro-2-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117117066 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-[4-chloro-2-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2ccc(Cl)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H11ClF3NO2/c13-7-1-2-8(9(4-7)12(14,15)16)10-3-6(5-17-10)11(18)19/h1-2,4,6,10,17H,3,5H2,(H,18,19) |
| InChIKey | KXIHXQHYFOMQKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |