5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid

C14H17NO4 — CID 117412403

IUPAC5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid
SMILESCCc1cc2c(cc1C1CC(C(=O)O)CN1)OCO2
InChIInChI=1S/C14H17NO4/c1-2-8-4-12-13(19-7-18-12)5-10(8)11-3-9(6-15-11)14(16)17/h4-5,9,11,15H,2-3,6-7H2,1H3,(H,16,17)
InChIKeyZFVWVRHQMVOXGE-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.71
Rot. Bonds3

About 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid

5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117412403) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid
PubChem CID117412403
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid
SMILESCCc1cc2c(cc1C1CC(C(=O)O)CN1)OCO2
InChIInChI=1S/C14H17NO4/c1-2-8-4-12-13(19-7-18-12)5-10(8)11-3-9(6-15-11)14(16)17/h4-5,9,11,15H,2-3,6-7H2,1H3,(H,16,17)
InChIKeyZFVWVRHQMVOXGE-UHFFFAOYSA-N
XLogP1.71
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (CID 117412403) is 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid is CCc1cc2c(cc1C1CC(C(=O)O)CN1)OCO2.
What is the InChIKey of 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid?
The InChIKey is ZFVWVRHQMVOXGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-2-8-4-12-13(19-7-18-12)5-10(8)11-3-9(6-15-11)14(16)17/h4-5,9,11,15H,2-3,6-7H2,1H3,(H,16,17).
What are the key properties of 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid?
5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid has a molecular weight of 263.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-ethyl-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 117412403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).