C11H10BrF2NO2 — CID 117491075
5-(3-bromo-2,6-difluorophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117491075) has the molecular formula C11H10BrF2NO2 and a molecular weight of 306.11 g/mol. Its IUPAC name is 5-(3-bromo-2,6-difluorophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(3-bromo-2,6-difluorophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117491075 |
| Molecular Formula | C11H10BrF2NO2 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 5-(3-bromo-2,6-difluorophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C11H10BrF2NO2/c12-6-1-2-7(13)9(10(6)14)8-3-5(4-15-8)11(16)17/h1-2,5,8,15H,3-4H2,(H,16,17) |
| InChIKey | WLXMTPMLGRSHBK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|