C9H12N2O3 — CID 83879757
2-piperidin-2-yl-1,3-oxazole-5-carboxylic acid (PubChem CID 83879757) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-piperidin-2-yl-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-piperidin-2-yl-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 83879757 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-piperidin-2-yl-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C2CCCCN2)o1 |
| InChI | InChI=1S/C9H12N2O3/c12-9(13)7-5-11-8(14-7)6-3-1-2-4-10-6/h5-6,10H,1-4H2,(H,12,13) |
| InChIKey | KCWPINADTCNIBO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |